C15H20N2S — CID 79820016
2,3-dimethyl-1-(4-phenyl-1,3-thiazol-2-yl)butan-2-amine (PubChem CID 79820016) has the molecular formula C15H20N2S and a molecular weight of 260.41 g/mol. Its IUPAC name is 2,3-dimethyl-1-(4-phenyl-1,3-thiazol-2-yl)butan-2-amine.
| Compound Name | 2,3-dimethyl-1-(4-phenyl-1,3-thiazol-2-yl)butan-2-amine |
|---|---|
| PubChem CID | 79820016 |
| Molecular Formula | C15H20N2S |
| Molecular Weight | 260.41 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 2,3-dimethyl-1-(4-phenyl-1,3-thiazol-2-yl)butan-2-amine |
| SMILES | CC(C)C(C)(N)Cc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C15H20N2S/c1-11(2)15(3,16)9-14-17-13(10-18-14)12-7-5-4-6-8-12/h4-8,10-11H,9,16H2,1-3H3 |
| InChIKey | BZLFWNYTQYZOCD-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |