C16H19NOS — CID 104656167
2-methyl-1-(4-phenyl-1,3-thiazol-2-yl)hex-5-en-2-ol (PubChem CID 104656167) has the molecular formula C16H19NOS and a molecular weight of 273.40 g/mol. Its IUPAC name is 2-methyl-1-(4-phenyl-1,3-thiazol-2-yl)hex-5-en-2-ol.
| Compound Name | 2-methyl-1-(4-phenyl-1,3-thiazol-2-yl)hex-5-en-2-ol |
|---|---|
| PubChem CID | 104656167 |
| Molecular Formula | C16H19NOS |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 2-methyl-1-(4-phenyl-1,3-thiazol-2-yl)hex-5-en-2-ol |
| SMILES | C=CCCC(C)(O)Cc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C16H19NOS/c1-3-4-10-16(2,18)11-15-17-14(12-19-15)13-8-6-5-7-9-13/h3,5-9,12,18H,1,4,10-11H2,2H3 |
| InChIKey | WYXZYBPMPVNTPF-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|