C15H18N2S — CID 115633034
N-[(4-phenyl-1,3-thiazol-2-yl)methyl]pent-4-en-2-amine (PubChem CID 115633034) has the molecular formula C15H18N2S and a molecular weight of 258.39 g/mol. Its IUPAC name is N-[(4-phenyl-1,3-thiazol-2-yl)methyl]pent-4-en-2-amine.
| Compound Name | N-[(4-phenyl-1,3-thiazol-2-yl)methyl]pent-4-en-2-amine |
|---|---|
| PubChem CID | 115633034 |
| Molecular Formula | C15H18N2S |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | N-[(4-phenyl-1,3-thiazol-2-yl)methyl]pent-4-en-2-amine |
| SMILES | C=CCC(C)NCc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C15H18N2S/c1-3-7-12(2)16-10-15-17-14(11-18-15)13-8-5-4-6-9-13/h3-6,8-9,11-12,16H,1,7,10H2,2H3 |
| InChIKey | RRPOUSXRQJEBNW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|