C17H24N2S — CID 65039690
3-ethyl-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]pentan-3-amine (PubChem CID 65039690) has the molecular formula C17H24N2S and a molecular weight of 288.46 g/mol. Its IUPAC name is 3-ethyl-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]pentan-3-amine.
| Compound Name | 3-ethyl-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]pentan-3-amine |
|---|---|
| PubChem CID | 65039690 |
| Molecular Formula | C17H24N2S |
| Molecular Weight | 288.46 g/mol |
| Exact Mass | 288.17 |
| IUPAC Name | 3-ethyl-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]pentan-3-amine |
| SMILES | CCC(CC)(CC)NCc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C17H24N2S/c1-4-17(5-2,6-3)18-12-16-19-15(13-20-16)14-10-8-7-9-11-14/h7-11,13,18H,4-6,12H2,1-3H3 |
| InChIKey | HYZFTGCFOGNOBP-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.46 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |