C17H22N2S — CID 62900718
2-cyclopentyl-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]ethanamine (PubChem CID 62900718) has the molecular formula C17H22N2S and a molecular weight of 286.44 g/mol. Its IUPAC name is 2-cyclopentyl-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]ethanamine.
| Compound Name | 2-cyclopentyl-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 62900718 |
| Molecular Formula | C17H22N2S |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.15 |
| IUPAC Name | 2-cyclopentyl-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]ethanamine |
| SMILES | c1ccc(-c2csc(CNCCC3CCCC3)n2)cc1 |
| InChI | InChI=1S/C17H22N2S/c1-2-8-15(9-3-1)16-13-20-17(19-16)12-18-11-10-14-6-4-5-7-14/h1-3,8-9,13-14,18H,4-7,10-12H2 |
| InChIKey | OUCZDRCVFQFBFA-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|