C16H22N2OS — CID 62900725
2-butoxy-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]ethanamine (PubChem CID 62900725) has the molecular formula C16H22N2OS and a molecular weight of 290.43 g/mol. Its IUPAC name is 2-butoxy-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]ethanamine.
| Compound Name | 2-butoxy-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 62900725 |
| Molecular Formula | C16H22N2OS |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | 2-butoxy-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]ethanamine |
| SMILES | CCCCOCCNCc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C16H22N2OS/c1-2-3-10-19-11-9-17-12-16-18-15(13-20-16)14-7-5-4-6-8-14/h4-8,13,17H,2-3,9-12H2,1H3 |
| InChIKey | MZCYBVJXDCECDY-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|