C14H19N3S — CID 62899204
N',N'-dimethyl-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]ethane-1,2-diamine (PubChem CID 62899204) has the molecular formula C14H19N3S and a molecular weight of 261.39 g/mol. Its IUPAC name is N',N'-dimethyl-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]ethane-1,2-diamine.
| Compound Name | N',N'-dimethyl-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 62899204 |
| Molecular Formula | C14H19N3S |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | N',N'-dimethyl-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]ethane-1,2-diamine |
| SMILES | CN(C)CCNCc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C14H19N3S/c1-17(2)9-8-15-10-14-16-13(11-18-14)12-6-4-3-5-7-12/h3-7,11,15H,8-10H2,1-2H3 |
| InChIKey | KNYUHGUEPSCLSD-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|