C13H11N3S2 — CID 113224729
N-[(4-phenyl-1,3-thiazol-2-yl)methyl]-1,3-thiazol-2-amine (PubChem CID 113224729) has the molecular formula C13H11N3S2 and a molecular weight of 273.39 g/mol. Its IUPAC name is N-[(4-phenyl-1,3-thiazol-2-yl)methyl]-1,3-thiazol-2-amine.
| Compound Name | N-[(4-phenyl-1,3-thiazol-2-yl)methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 113224729 |
| Molecular Formula | C13H11N3S2 |
| Molecular Weight | 273.39 g/mol |
| Exact Mass | 273.04 |
| IUPAC Name | N-[(4-phenyl-1,3-thiazol-2-yl)methyl]-1,3-thiazol-2-amine |
| SMILES | c1ccc(-c2csc(CNc3nccs3)n2)cc1 |
| InChI | InChI=1S/C13H11N3S2/c1-2-4-10(5-3-1)11-9-18-12(16-11)8-15-13-14-6-7-17-13/h1-7,9H,8H2,(H,14,15) |
| InChIKey | ZXNUTYXGHGDGLK-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.39 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |