C14H17N3S — CID 105269689
1-(4-phenyl-1,3-thiazol-2-yl)pent-4-en-2-ylhydrazine (PubChem CID 105269689) has the molecular formula C14H17N3S and a molecular weight of 259.38 g/mol. Its IUPAC name is 1-(4-phenyl-1,3-thiazol-2-yl)pent-4-en-2-ylhydrazine.
| Compound Name | 1-(4-phenyl-1,3-thiazol-2-yl)pent-4-en-2-ylhydrazine |
|---|---|
| PubChem CID | 105269689 |
| Molecular Formula | C14H17N3S |
| Molecular Weight | 259.38 g/mol |
| Exact Mass | 259.11 |
| IUPAC Name | 1-(4-phenyl-1,3-thiazol-2-yl)pent-4-en-2-ylhydrazine |
| SMILES | C=CCC(Cc1nc(-c2ccccc2)cs1)NN |
| InChI | InChI=1S/C14H17N3S/c1-2-6-12(17-15)9-14-16-13(10-18-14)11-7-4-3-5-8-11/h2-5,7-8,10,12,17H,1,6,9,15H2 |
| InChIKey | SOVYRNIUGBPROQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.38 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|