C15H20N2OS — CID 79820048
4-methoxy-N-methyl-1-(4-phenyl-1,3-thiazol-2-yl)butan-2-amine (PubChem CID 79820048) has the molecular formula C15H20N2OS and a molecular weight of 276.40 g/mol. Its IUPAC name is 4-methoxy-N-methyl-1-(4-phenyl-1,3-thiazol-2-yl)butan-2-amine.
| Compound Name | 4-methoxy-N-methyl-1-(4-phenyl-1,3-thiazol-2-yl)butan-2-amine |
|---|---|
| PubChem CID | 79820048 |
| Molecular Formula | C15H20N2OS |
| Molecular Weight | 276.40 g/mol |
| Exact Mass | 276.13 |
| IUPAC Name | 4-methoxy-N-methyl-1-(4-phenyl-1,3-thiazol-2-yl)butan-2-amine |
| SMILES | CNC(CCOC)Cc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C15H20N2OS/c1-16-13(8-9-18-2)10-15-17-14(11-19-15)12-6-4-3-5-7-12/h3-7,11,13,16H,8-10H2,1-2H3 |
| InChIKey | IOYRMQKVLPIZTG-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.40 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |