C17H24N2OS — CID 79825345
4-methoxy-1-(4-phenyl-1,3-thiazol-2-yl)-N-propylbutan-2-amine (PubChem CID 79825345) has the molecular formula C17H24N2OS and a molecular weight of 304.46 g/mol. Its IUPAC name is 4-methoxy-1-(4-phenyl-1,3-thiazol-2-yl)-N-propylbutan-2-amine.
| Compound Name | 4-methoxy-1-(4-phenyl-1,3-thiazol-2-yl)-N-propylbutan-2-amine |
|---|---|
| PubChem CID | 79825345 |
| Molecular Formula | C17H24N2OS |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 4-methoxy-1-(4-phenyl-1,3-thiazol-2-yl)-N-propylbutan-2-amine |
| SMILES | CCCNC(CCOC)Cc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C17H24N2OS/c1-3-10-18-15(9-11-20-2)12-17-19-16(13-21-17)14-7-5-4-6-8-14/h4-8,13,15,18H,3,9-12H2,1-2H3 |
| InChIKey | KTIQYCNJADRJAW-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |