C15H20N2S — CID 79819889
N-methyl-1-(4-phenyl-1,3-thiazol-2-yl)pentan-2-amine (PubChem CID 79819889) has the molecular formula C15H20N2S and a molecular weight of 260.41 g/mol. Its IUPAC name is N-methyl-1-(4-phenyl-1,3-thiazol-2-yl)pentan-2-amine.
| Compound Name | N-methyl-1-(4-phenyl-1,3-thiazol-2-yl)pentan-2-amine |
|---|---|
| PubChem CID | 79819889 |
| Molecular Formula | C15H20N2S |
| Molecular Weight | 260.41 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | N-methyl-1-(4-phenyl-1,3-thiazol-2-yl)pentan-2-amine |
| SMILES | CCCC(Cc1nc(-c2ccccc2)cs1)NC |
| InChI | InChI=1S/C15H20N2S/c1-3-7-13(16-2)10-15-17-14(11-18-15)12-8-5-4-6-9-12/h4-6,8-9,11,13,16H,3,7,10H2,1-2H3 |
| InChIKey | XTQAZTHEFOXTPI-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.41 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |