C16H23N3S — CID 105320685
[3-methyl-1-(4-phenyl-1,3-thiazol-2-yl)hexan-2-yl]hydrazine (PubChem CID 105320685) has the molecular formula C16H23N3S and a molecular weight of 289.45 g/mol. Its IUPAC name is [3-methyl-1-(4-phenyl-1,3-thiazol-2-yl)hexan-2-yl]hydrazine.
| Compound Name | [3-methyl-1-(4-phenyl-1,3-thiazol-2-yl)hexan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105320685 |
| Molecular Formula | C16H23N3S |
| Molecular Weight | 289.45 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | [3-methyl-1-(4-phenyl-1,3-thiazol-2-yl)hexan-2-yl]hydrazine |
| SMILES | CCCC(C)C(Cc1nc(-c2ccccc2)cs1)NN |
| InChI | InChI=1S/C16H23N3S/c1-3-7-12(2)14(19-17)10-16-18-15(11-20-16)13-8-5-4-6-9-13/h4-6,8-9,11-12,14,19H,3,7,10,17H2,1-2H3 |
| InChIKey | RWUQAILHBXTYRQ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|