C11H11NO2S2 — CID 66972700
2-(methylsulfonylmethyl)-4-phenyl-1,3-thiazole (PubChem CID 66972700) has the molecular formula C11H11NO2S2 and a molecular weight of 253.35 g/mol. Its IUPAC name is 2-(methylsulfonylmethyl)-4-phenyl-1,3-thiazole.
| Compound Name | 2-(methylsulfonylmethyl)-4-phenyl-1,3-thiazole |
|---|---|
| PubChem CID | 66972700 |
| Molecular Formula | C11H11NO2S2 |
| Molecular Weight | 253.35 g/mol |
| Exact Mass | 253.02 |
| IUPAC Name | 2-(methylsulfonylmethyl)-4-phenyl-1,3-thiazole |
| SMILES | CS(=O)(=O)Cc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C11H11NO2S2/c1-16(13,14)8-11-12-10(7-15-11)9-5-3-2-4-6-9/h2-7H,8H2,1H3 |
| InChIKey | OMQOPCDBPCVCES-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |