C11H12N2O2S2 — CID 62474009
3-[2-(methylsulfonylmethyl)-1,3-thiazol-4-yl]aniline (PubChem CID 62474009) has the molecular formula C11H12N2O2S2 and a molecular weight of 268.36 g/mol. Its IUPAC name is 3-[2-(methylsulfonylmethyl)-1,3-thiazol-4-yl]aniline.
| Compound Name | 3-[2-(methylsulfonylmethyl)-1,3-thiazol-4-yl]aniline |
|---|---|
| PubChem CID | 62474009 |
| Molecular Formula | C11H12N2O2S2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.03 |
| IUPAC Name | 3-[2-(methylsulfonylmethyl)-1,3-thiazol-4-yl]aniline |
| SMILES | CS(=O)(=O)Cc1nc(-c2cccc(N)c2)cs1 |
| InChI | InChI=1S/C11H12N2O2S2/c1-17(14,15)7-11-13-10(6-16-11)8-3-2-4-9(12)5-8/h2-6H,7,12H2,1H3 |
| InChIKey | BECCQHFLDXAZQS-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|