C17H21N3OS — CID 94761011
2-[4-(3-aminophenyl)-1,3-thiazol-2-yl]-1-(azepan-1-yl)ethanone (PubChem CID 94761011) has the molecular formula C17H21N3OS and a molecular weight of 315.44 g/mol. Its IUPAC name is 2-[4-(3-aminophenyl)-1,3-thiazol-2-yl]-1-(azepan-1-yl)ethanone.
| Compound Name | 2-[4-(3-aminophenyl)-1,3-thiazol-2-yl]-1-(azepan-1-yl)ethanone |
|---|---|
| PubChem CID | 94761011 |
| Molecular Formula | C17H21N3OS |
| Molecular Weight | 315.44 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 2-[4-(3-aminophenyl)-1,3-thiazol-2-yl]-1-(azepan-1-yl)ethanone |
| SMILES | Nc1cccc(-c2csc(CC(=O)N3CCCCCC3)n2)c1 |
| InChI | InChI=1S/C17H21N3OS/c18-14-7-5-6-13(10-14)15-12-22-16(19-15)11-17(21)20-8-3-1-2-4-9-20/h5-7,10,12H,1-4,8-9,11,18H2 |
| InChIKey | MRWPZGGQQGVNAK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.44 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|