C19H20N2S — CID 94760682
3-[2-[(2,4,6-trimethylphenyl)methyl]-1,3-thiazol-4-yl]aniline (PubChem CID 94760682) has the molecular formula C19H20N2S and a molecular weight of 308.45 g/mol. Its IUPAC name is 3-[2-[(2,4,6-trimethylphenyl)methyl]-1,3-thiazol-4-yl]aniline.
| Compound Name | 3-[2-[(2,4,6-trimethylphenyl)methyl]-1,3-thiazol-4-yl]aniline |
|---|---|
| PubChem CID | 94760682 |
| Molecular Formula | C19H20N2S |
| Molecular Weight | 308.45 g/mol |
| Exact Mass | 308.13 |
| IUPAC Name | 3-[2-[(2,4,6-trimethylphenyl)methyl]-1,3-thiazol-4-yl]aniline |
| SMILES | Cc1cc(C)c(Cc2nc(-c3cccc(N)c3)cs2)c(C)c1 |
| InChI | InChI=1S/C19H20N2S/c1-12-7-13(2)17(14(3)8-12)10-19-21-18(11-22-19)15-5-4-6-16(20)9-15/h4-9,11H,10,20H2,1-3H3 |
| InChIKey | PELUGYROFDTDIB-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.45 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|