C19H20N2OS — CID 82154267
3-[2-[3-(2-methylphenoxy)propyl]-1,3-thiazol-4-yl]aniline (PubChem CID 82154267) has the molecular formula C19H20N2OS and a molecular weight of 324.45 g/mol. Its IUPAC name is 3-[2-[3-(2-methylphenoxy)propyl]-1,3-thiazol-4-yl]aniline.
| Compound Name | 3-[2-[3-(2-methylphenoxy)propyl]-1,3-thiazol-4-yl]aniline |
|---|---|
| PubChem CID | 82154267 |
| Molecular Formula | C19H20N2OS |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 3-[2-[3-(2-methylphenoxy)propyl]-1,3-thiazol-4-yl]aniline |
| SMILES | Cc1ccccc1OCCCc1nc(-c2cccc(N)c2)cs1 |
| InChI | InChI=1S/C19H20N2OS/c1-14-6-2-3-9-18(14)22-11-5-10-19-21-17(13-23-19)15-7-4-8-16(20)12-15/h2-4,6-9,12-13H,5,10-11,20H2,1H3 |
| InChIKey | RMMORIRJWNIBKS-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|