C17H17N3OS — CID 94778254
3-[3-(4-pyridin-2-yl-1,3-thiazol-2-yl)propoxy]aniline (PubChem CID 94778254) has the molecular formula C17H17N3OS and a molecular weight of 311.41 g/mol. Its IUPAC name is 3-[3-(4-pyridin-2-yl-1,3-thiazol-2-yl)propoxy]aniline.
| Compound Name | 3-[3-(4-pyridin-2-yl-1,3-thiazol-2-yl)propoxy]aniline |
|---|---|
| PubChem CID | 94778254 |
| Molecular Formula | C17H17N3OS |
| Molecular Weight | 311.41 g/mol |
| Exact Mass | 311.11 |
| IUPAC Name | 3-[3-(4-pyridin-2-yl-1,3-thiazol-2-yl)propoxy]aniline |
| SMILES | Nc1cccc(OCCCc2nc(-c3ccccn3)cs2)c1 |
| InChI | InChI=1S/C17H17N3OS/c18-13-5-3-6-14(11-13)21-10-4-8-17-20-16(12-22-17)15-7-1-2-9-19-15/h1-3,5-7,9,11-12H,4,8,10,18H2 |
| InChIKey | YCSLQVCEHXLFHO-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.41 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|