C16H16FN5S — CID 126840181
6-fluoro-N-[4-(4-pyridin-2-yl-1,3-thiazol-2-yl)butyl]pyrimidin-4-amine (PubChem CID 126840181) has the molecular formula C16H16FN5S and a molecular weight of 329.40 g/mol. Its IUPAC name is 6-fluoro-N-[4-(4-pyridin-2-yl-1,3-thiazol-2-yl)butyl]pyrimidin-4-amine.
| Compound Name | 6-fluoro-N-[4-(4-pyridin-2-yl-1,3-thiazol-2-yl)butyl]pyrimidin-4-amine |
|---|---|
| PubChem CID | 126840181 |
| Molecular Formula | C16H16FN5S |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.11 |
| IUPAC Name | 6-fluoro-N-[4-(4-pyridin-2-yl-1,3-thiazol-2-yl)butyl]pyrimidin-4-amine |
| SMILES | Fc1cc(NCCCCc2nc(-c3ccccn3)cs2)ncn1 |
| InChI | InChI=1S/C16H16FN5S/c17-14-9-15(21-11-20-14)19-8-4-2-6-16-22-13(10-23-16)12-5-1-3-7-18-12/h1,3,5,7,9-11H,2,4,6,8H2,(H,19,20,21) |
| InChIKey | GHNSIBRQZPUOBZ-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 63.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|