C17H13F2N3OS — CID 146126257
2,4-difluoro-N-[2-(4-pyridin-2-yl-1,3-thiazol-2-yl)ethyl]benzamide (PubChem CID 146126257) has the molecular formula C17H13F2N3OS and a molecular weight of 345.37 g/mol. Its IUPAC name is 2,4-difluoro-N-[2-(4-pyridin-2-yl-1,3-thiazol-2-yl)ethyl]benzamide.
| Compound Name | 2,4-difluoro-N-[2-(4-pyridin-2-yl-1,3-thiazol-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 146126257 |
| Molecular Formula | C17H13F2N3OS |
| Molecular Weight | 345.37 g/mol |
| Exact Mass | 345.07 |
| IUPAC Name | 2,4-difluoro-N-[2-(4-pyridin-2-yl-1,3-thiazol-2-yl)ethyl]benzamide |
| SMILES | O=C(NCCc1nc(-c2ccccn2)cs1)c1ccc(F)cc1F |
| InChI | InChI=1S/C17H13F2N3OS/c18-11-4-5-12(13(19)9-11)17(23)21-8-6-16-22-15(10-24-16)14-3-1-2-7-20-14/h1-5,7,9-10H,6,8H2,(H,21,23) |
| InChIKey | LXYZTBYINHXVSA-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.37 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |