C12H10F2N2OS — CID 49356336
2,4-difluoro-N-[2-(1,3-thiazol-2-yl)ethyl]benzamide (PubChem CID 49356336) has the molecular formula C12H10F2N2OS and a molecular weight of 268.29 g/mol. Its IUPAC name is 2,4-difluoro-N-[2-(1,3-thiazol-2-yl)ethyl]benzamide.
| Compound Name | 2,4-difluoro-N-[2-(1,3-thiazol-2-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 49356336 |
| Molecular Formula | C12H10F2N2OS |
| Molecular Weight | 268.29 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 2,4-difluoro-N-[2-(1,3-thiazol-2-yl)ethyl]benzamide |
| SMILES | O=C(NCCc1nccs1)c1ccc(F)cc1F |
| InChI | InChI=1S/C12H10F2N2OS/c13-8-1-2-9(10(14)7-8)12(17)16-4-3-11-15-5-6-18-11/h1-2,5-7H,3-4H2,(H,16,17) |
| InChIKey | ASTNMCIWASJLQA-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.29 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |