C11H10FN3OS — CID 110474816
3-fluoro-N-[2-(1,3-thiazol-2-yl)ethyl]pyridine-2-carboxamide (PubChem CID 110474816) has the molecular formula C11H10FN3OS and a molecular weight of 251.29 g/mol. Its IUPAC name is 3-fluoro-N-[2-(1,3-thiazol-2-yl)ethyl]pyridine-2-carboxamide.
| Compound Name | 3-fluoro-N-[2-(1,3-thiazol-2-yl)ethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 110474816 |
| Molecular Formula | C11H10FN3OS |
| Molecular Weight | 251.29 g/mol |
| Exact Mass | 251.05 |
| IUPAC Name | 3-fluoro-N-[2-(1,3-thiazol-2-yl)ethyl]pyridine-2-carboxamide |
| SMILES | O=C(NCCc1nccs1)c1ncccc1F |
| InChI | InChI=1S/C11H10FN3OS/c12-8-2-1-4-14-10(8)11(16)15-5-3-9-13-6-7-17-9/h1-2,4,6-7H,3,5H2,(H,15,16) |
| InChIKey | MUGDHZWILYQPSD-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.29 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |