C14H19N3O2S2 — CID 110317579
N-[2-(4-pyridin-2-yl-1,3-thiazol-2-yl)ethyl]butane-1-sulfonamide (PubChem CID 110317579) has the molecular formula C14H19N3O2S2 and a molecular weight of 325.46 g/mol. Its IUPAC name is N-[2-(4-pyridin-2-yl-1,3-thiazol-2-yl)ethyl]butane-1-sulfonamide.
| Compound Name | N-[2-(4-pyridin-2-yl-1,3-thiazol-2-yl)ethyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 110317579 |
| Molecular Formula | C14H19N3O2S2 |
| Molecular Weight | 325.46 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | N-[2-(4-pyridin-2-yl-1,3-thiazol-2-yl)ethyl]butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)NCCc1nc(-c2ccccn2)cs1 |
| InChI | InChI=1S/C14H19N3O2S2/c1-2-3-10-21(18,19)16-9-7-14-17-13(11-20-14)12-6-4-5-8-15-12/h4-6,8,11,16H,2-3,7,9-10H2,1H3 |
| InChIKey | SPTVQSRXLJNIQE-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 71.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.46 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |