C17H16N4OS — CID 110317549
1-phenyl-3-[2-(4-pyridin-2-yl-1,3-thiazol-2-yl)ethyl]urea (PubChem CID 110317549) has the molecular formula C17H16N4OS and a molecular weight of 324.41 g/mol. Its IUPAC name is 1-phenyl-3-[2-(4-pyridin-2-yl-1,3-thiazol-2-yl)ethyl]urea.
| Compound Name | 1-phenyl-3-[2-(4-pyridin-2-yl-1,3-thiazol-2-yl)ethyl]urea |
|---|---|
| PubChem CID | 110317549 |
| Molecular Formula | C17H16N4OS |
| Molecular Weight | 324.41 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | 1-phenyl-3-[2-(4-pyridin-2-yl-1,3-thiazol-2-yl)ethyl]urea |
| SMILES | O=C(NCCc1nc(-c2ccccn2)cs1)Nc1ccccc1 |
| InChI | InChI=1S/C17H16N4OS/c22-17(20-13-6-2-1-3-7-13)19-11-9-16-21-15(12-23-16)14-8-4-5-10-18-14/h1-8,10,12H,9,11H2,(H2,19,20,22) |
| InChIKey | BCZROIRWCONIAE-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.41 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |