C13H18N4S — CID 18440299
N'-(4-pyridin-2-yl-1,3-thiazol-2-yl)pentane-1,5-diamine (PubChem CID 18440299) has the molecular formula C13H18N4S and a molecular weight of 262.38 g/mol. Its IUPAC name is N'-(4-pyridin-2-yl-1,3-thiazol-2-yl)pentane-1,5-diamine.
| Compound Name | N'-(4-pyridin-2-yl-1,3-thiazol-2-yl)pentane-1,5-diamine |
|---|---|
| PubChem CID | 18440299 |
| Molecular Formula | C13H18N4S |
| Molecular Weight | 262.38 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | N'-(4-pyridin-2-yl-1,3-thiazol-2-yl)pentane-1,5-diamine |
| SMILES | NCCCCCNc1nc(-c2ccccn2)cs1 |
| InChI | InChI=1S/C13H18N4S/c14-7-3-1-4-9-16-13-17-12(10-18-13)11-6-2-5-8-15-11/h2,5-6,8,10H,1,3-4,7,9,14H2,(H,16,17) |
| InChIKey | SGGTWZDGUSRZAG-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.38 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|