C12H16N4S — CID 60893739
N'-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]propane-1,3-diamine (PubChem CID 60893739) has the molecular formula C12H16N4S and a molecular weight of 248.36 g/mol. Its IUPAC name is N'-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]propane-1,3-diamine.
| Compound Name | N'-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 60893739 |
| Molecular Formula | C12H16N4S |
| Molecular Weight | 248.36 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | N'-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]propane-1,3-diamine |
| SMILES | NCCCNCc1csc(-c2ccccn2)n1 |
| InChI | InChI=1S/C12H16N4S/c13-5-3-6-14-8-10-9-17-12(16-10)11-4-1-2-7-15-11/h1-2,4,7,9,14H,3,5-6,8,13H2 |
| InChIKey | LZOGUSGXVXZWKU-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.36 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|