C19H22N4S — CID 119126486
N'-methyl-N'-phenyl-N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]propane-1,3-diamine (PubChem CID 119126486) has the molecular formula C19H22N4S and a molecular weight of 338.48 g/mol. Its IUPAC name is N'-methyl-N'-phenyl-N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]propane-1,3-diamine.
| Compound Name | N'-methyl-N'-phenyl-N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]propane-1,3-diamine |
|---|---|
| PubChem CID | 119126486 |
| Molecular Formula | C19H22N4S |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | N'-methyl-N'-phenyl-N-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methyl]propane-1,3-diamine |
| SMILES | CN(CCCNCc1csc(-c2ccccn2)n1)c1ccccc1 |
| InChI | InChI=1S/C19H22N4S/c1-23(17-8-3-2-4-9-17)13-7-11-20-14-16-15-24-19(22-16)18-10-5-6-12-21-18/h2-6,8-10,12,15,20H,7,11,13-14H2,1H3 |
| InChIKey | QVAIMPFKYNMBOY-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|