C13H16N4OS — CID 60863942
4-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methylamino]butanamide (PubChem CID 60863942) has the molecular formula C13H16N4OS and a molecular weight of 276.37 g/mol. Its IUPAC name is 4-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methylamino]butanamide.
| Compound Name | 4-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methylamino]butanamide |
|---|---|
| PubChem CID | 60863942 |
| Molecular Formula | C13H16N4OS |
| Molecular Weight | 276.37 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 4-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methylamino]butanamide |
| SMILES | NC(=O)CCCNCc1csc(-c2ccccn2)n1 |
| InChI | InChI=1S/C13H16N4OS/c14-12(18)5-3-6-15-8-10-9-19-13(17-10)11-4-1-2-7-16-11/h1-2,4,7,9,15H,3,5-6,8H2,(H2,14,18) |
| InChIKey | PAXAKZMQGIDJKP-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.37 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|