C15H20N4OS — CID 115582676
N-propan-2-yl-3-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methylamino]propanamide (PubChem CID 115582676) has the molecular formula C15H20N4OS and a molecular weight of 304.42 g/mol. Its IUPAC name is N-propan-2-yl-3-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methylamino]propanamide.
| Compound Name | N-propan-2-yl-3-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methylamino]propanamide |
|---|---|
| PubChem CID | 115582676 |
| Molecular Formula | C15H20N4OS |
| Molecular Weight | 304.42 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | N-propan-2-yl-3-[(2-pyridin-2-yl-1,3-thiazol-4-yl)methylamino]propanamide |
| SMILES | CC(C)NC(=O)CCNCc1csc(-c2ccccn2)n1 |
| InChI | InChI=1S/C15H20N4OS/c1-11(2)18-14(20)6-8-16-9-12-10-21-15(19-12)13-5-3-4-7-17-13/h3-5,7,10-11,16H,6,8-9H2,1-2H3,(H,18,20) |
| InChIKey | XLUFUFAXOBHSOE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.42 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|