C16H20BrN3OS — CID 119111004
3-[[2-(3-bromophenyl)-1,3-thiazol-4-yl]methylamino]-N-propan-2-ylpropanamide (PubChem CID 119111004) has the molecular formula C16H20BrN3OS and a molecular weight of 382.33 g/mol. Its IUPAC name is 3-[[2-(3-bromophenyl)-1,3-thiazol-4-yl]methylamino]-N-propan-2-ylpropanamide.
| Compound Name | 3-[[2-(3-bromophenyl)-1,3-thiazol-4-yl]methylamino]-N-propan-2-ylpropanamide |
|---|---|
| PubChem CID | 119111004 |
| Molecular Formula | C16H20BrN3OS |
| Molecular Weight | 382.33 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | 3-[[2-(3-bromophenyl)-1,3-thiazol-4-yl]methylamino]-N-propan-2-ylpropanamide |
| SMILES | CC(C)NC(=O)CCNCc1csc(-c2cccc(Br)c2)n1 |
| InChI | InChI=1S/C16H20BrN3OS/c1-11(2)19-15(21)6-7-18-9-14-10-22-16(20-14)12-4-3-5-13(17)8-12/h3-5,8,10-11,18H,6-7,9H2,1-2H3,(H,19,21) |
| InChIKey | ACZKJZPLYSRTGG-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.33 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|