C15H18BrN3OS — CID 119111398
N-[3-[[2-(3-bromophenyl)-1,3-thiazol-4-yl]methylamino]propyl]acetamide (PubChem CID 119111398) has the molecular formula C15H18BrN3OS and a molecular weight of 368.30 g/mol. Its IUPAC name is N-[3-[[2-(3-bromophenyl)-1,3-thiazol-4-yl]methylamino]propyl]acetamide.
| Compound Name | N-[3-[[2-(3-bromophenyl)-1,3-thiazol-4-yl]methylamino]propyl]acetamide |
|---|---|
| PubChem CID | 119111398 |
| Molecular Formula | C15H18BrN3OS |
| Molecular Weight | 368.30 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | N-[3-[[2-(3-bromophenyl)-1,3-thiazol-4-yl]methylamino]propyl]acetamide |
| SMILES | CC(=O)NCCCNCc1csc(-c2cccc(Br)c2)n1 |
| InChI | InChI=1S/C15H18BrN3OS/c1-11(20)18-7-3-6-17-9-14-10-21-15(19-14)12-4-2-5-13(16)8-12/h2,4-5,8,10,17H,3,6-7,9H2,1H3,(H,18,20) |
| InChIKey | YKCXTQBGXXRNNP-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.30 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|