C16H20N4O2S — CID 110450412
N-(2-acetamidoethyl)-2-[2-[3-(aminomethyl)phenyl]-1,3-thiazol-4-yl]acetamide (PubChem CID 110450412) has the molecular formula C16H20N4O2S and a molecular weight of 332.43 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-2-[2-[3-(aminomethyl)phenyl]-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-(2-acetamidoethyl)-2-[2-[3-(aminomethyl)phenyl]-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 110450412 |
| Molecular Formula | C16H20N4O2S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | N-(2-acetamidoethyl)-2-[2-[3-(aminomethyl)phenyl]-1,3-thiazol-4-yl]acetamide |
| SMILES | CC(=O)NCCNC(=O)Cc1csc(-c2cccc(CN)c2)n1 |
| InChI | InChI=1S/C16H20N4O2S/c1-11(21)18-5-6-19-15(22)8-14-10-23-16(20-14)13-4-2-3-12(7-13)9-17/h2-4,7,10H,5-6,8-9,17H2,1H3,(H,18,21)(H,19,22) |
| InChIKey | OXWSOJQJWGMXEU-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|