C14H16N4O2S — CID 39084427
N-(2-acetamidoethyl)-2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetamide (PubChem CID 39084427) has the molecular formula C14H16N4O2S and a molecular weight of 304.38 g/mol. Its IUPAC name is N-(2-acetamidoethyl)-2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-(2-acetamidoethyl)-2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 39084427 |
| Molecular Formula | C14H16N4O2S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.10 |
| IUPAC Name | N-(2-acetamidoethyl)-2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetamide |
| SMILES | CC(=O)NCCNC(=O)Cc1csc(-c2cccnc2)n1 |
| InChI | InChI=1S/C14H16N4O2S/c1-10(19)16-5-6-17-13(20)7-12-9-21-14(18-12)11-3-2-4-15-8-11/h2-4,8-9H,5-7H2,1H3,(H,16,19)(H,17,20) |
| InChIKey | PQRTYOIFDMHNEA-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|