C16H19F3N4OS — CID 55720543
N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetamide (PubChem CID 55720543) has the molecular formula C16H19F3N4OS and a molecular weight of 372.42 g/mol. Its IUPAC name is N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 55720543 |
| Molecular Formula | C16H19F3N4OS |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | N-[3-[methyl(2,2,2-trifluoroethyl)amino]propyl]-2-(2-pyridin-3-yl-1,3-thiazol-4-yl)acetamide |
| SMILES | CN(CCCNC(=O)Cc1csc(-c2cccnc2)n1)CC(F)(F)F |
| InChI | InChI=1S/C16H19F3N4OS/c1-23(11-16(17,18)19)7-3-6-21-14(24)8-13-10-25-15(22-13)12-4-2-5-20-9-12/h2,4-5,9-10H,3,6-8,11H2,1H3,(H,21,24) |
| InChIKey | QUJUJRMOQGWJKU-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|