C17H24N4OS — CID 39084376
N-[3-(diethylamino)propyl]-2-(2-pyridin-4-yl-1,3-thiazol-4-yl)acetamide (PubChem CID 39084376) has the molecular formula C17H24N4OS and a molecular weight of 332.47 g/mol. Its IUPAC name is N-[3-(diethylamino)propyl]-2-(2-pyridin-4-yl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-[3-(diethylamino)propyl]-2-(2-pyridin-4-yl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 39084376 |
| Molecular Formula | C17H24N4OS |
| Molecular Weight | 332.47 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | N-[3-(diethylamino)propyl]-2-(2-pyridin-4-yl-1,3-thiazol-4-yl)acetamide |
| SMILES | CCN(CC)CCCNC(=O)Cc1csc(-c2ccncc2)n1 |
| InChI | InChI=1S/C17H24N4OS/c1-3-21(4-2)11-5-8-19-16(22)12-15-13-23-17(20-15)14-6-9-18-10-7-14/h6-7,9-10,13H,3-5,8,11-12H2,1-2H3,(H,19,22) |
| InChIKey | LPMZCMVHKRDJMQ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.47 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|