C17H23N3O3S2 — CID 55956493
N-[3-[ethyl(methylsulfonyl)amino]propyl]-2-(2-phenyl-1,3-thiazol-4-yl)acetamide (PubChem CID 55956493) has the molecular formula C17H23N3O3S2 and a molecular weight of 381.52 g/mol. Its IUPAC name is N-[3-[ethyl(methylsulfonyl)amino]propyl]-2-(2-phenyl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-[3-[ethyl(methylsulfonyl)amino]propyl]-2-(2-phenyl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 55956493 |
| Molecular Formula | C17H23N3O3S2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | N-[3-[ethyl(methylsulfonyl)amino]propyl]-2-(2-phenyl-1,3-thiazol-4-yl)acetamide |
| SMILES | CCN(CCCNC(=O)Cc1csc(-c2ccccc2)n1)S(C)(=O)=O |
| InChI | InChI=1S/C17H23N3O3S2/c1-3-20(25(2,22)23)11-7-10-18-16(21)12-15-13-24-17(19-15)14-8-5-4-6-9-14/h4-6,8-9,13H,3,7,10-12H2,1-2H3,(H,18,21) |
| InChIKey | IRARURXNBYGNLU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|