C22H24N2O3S2 — CID 78900004
N-(3-benzylsulfonylpropyl)-2-[2-(3-methylphenyl)-1,3-thiazol-4-yl]acetamide (PubChem CID 78900004) has the molecular formula C22H24N2O3S2 and a molecular weight of 428.58 g/mol. Its IUPAC name is N-(3-benzylsulfonylpropyl)-2-[2-(3-methylphenyl)-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-(3-benzylsulfonylpropyl)-2-[2-(3-methylphenyl)-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 78900004 |
| Molecular Formula | C22H24N2O3S2 |
| Molecular Weight | 428.58 g/mol |
| Exact Mass | 428.12 |
| IUPAC Name | N-(3-benzylsulfonylpropyl)-2-[2-(3-methylphenyl)-1,3-thiazol-4-yl]acetamide |
| SMILES | Cc1cccc(-c2nc(CC(=O)NCCCS(=O)(=O)Cc3ccccc3)cs2)c1 |
| InChI | InChI=1S/C22H24N2O3S2/c1-17-7-5-10-19(13-17)22-24-20(15-28-22)14-21(25)23-11-6-12-29(26,27)16-18-8-3-2-4-9-18/h2-5,7-10,13,15H,6,11-12,14,16H2,1H3,(H,23,25) |
| InChIKey | VVHHYGQRMDQJHZ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.58 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|