C19H17BrN2O2S — CID 29426799
2-[2-(3-bromophenyl)-1,3-thiazol-4-yl]-N-(2-phenoxyethyl)acetamide (PubChem CID 29426799) has the molecular formula C19H17BrN2O2S and a molecular weight of 417.33 g/mol. Its IUPAC name is 2-[2-(3-bromophenyl)-1,3-thiazol-4-yl]-N-(2-phenoxyethyl)acetamide.
| Compound Name | 2-[2-(3-bromophenyl)-1,3-thiazol-4-yl]-N-(2-phenoxyethyl)acetamide |
|---|---|
| PubChem CID | 29426799 |
| Molecular Formula | C19H17BrN2O2S |
| Molecular Weight | 417.33 g/mol |
| Exact Mass | 416.02 |
| IUPAC Name | 2-[2-(3-bromophenyl)-1,3-thiazol-4-yl]-N-(2-phenoxyethyl)acetamide |
| SMILES | O=C(Cc1csc(-c2cccc(Br)c2)n1)NCCOc1ccccc1 |
| InChI | InChI=1S/C19H17BrN2O2S/c20-15-6-4-5-14(11-15)19-22-16(13-25-19)12-18(23)21-9-10-24-17-7-2-1-3-8-17/h1-8,11,13H,9-10,12H2,(H,21,23) |
| InChIKey | VDLIWTQQXVDPOS-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.33 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|