C18H17BrN2O3S2 — CID 55884855
2-[2-(4-bromothiophen-2-yl)-1,3-thiazol-4-yl]-N-[2-(3-methoxyphenoxy)ethyl]acetamide (PubChem CID 55884855) has the molecular formula C18H17BrN2O3S2 and a molecular weight of 453.38 g/mol. Its IUPAC name is 2-[2-(4-bromothiophen-2-yl)-1,3-thiazol-4-yl]-N-[2-(3-methoxyphenoxy)ethyl]acetamide.
| Compound Name | 2-[2-(4-bromothiophen-2-yl)-1,3-thiazol-4-yl]-N-[2-(3-methoxyphenoxy)ethyl]acetamide |
|---|---|
| PubChem CID | 55884855 |
| Molecular Formula | C18H17BrN2O3S2 |
| Molecular Weight | 453.38 g/mol |
| Exact Mass | 451.99 |
| IUPAC Name | 2-[2-(4-bromothiophen-2-yl)-1,3-thiazol-4-yl]-N-[2-(3-methoxyphenoxy)ethyl]acetamide |
| SMILES | COc1cccc(OCCNC(=O)Cc2csc(-c3cc(Br)cs3)n2)c1 |
| InChI | InChI=1S/C18H17BrN2O3S2/c1-23-14-3-2-4-15(9-14)24-6-5-20-17(22)8-13-11-26-18(21-13)16-7-12(19)10-25-16/h2-4,7,9-11H,5-6,8H2,1H3,(H,20,22) |
| InChIKey | SHCXJLCAIBODGP-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.38 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|