C18H15BrN4OS3 — CID 55886169
N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-2-[2-(4-bromothiophen-2-yl)-1,3-thiazol-4-yl]acetamide (PubChem CID 55886169) has the molecular formula C18H15BrN4OS3 and a molecular weight of 479.45 g/mol. Its IUPAC name is N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-2-[2-(4-bromothiophen-2-yl)-1,3-thiazol-4-yl]acetamide.
| Compound Name | N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-2-[2-(4-bromothiophen-2-yl)-1,3-thiazol-4-yl]acetamide |
|---|---|
| PubChem CID | 55886169 |
| Molecular Formula | C18H15BrN4OS3 |
| Molecular Weight | 479.45 g/mol |
| Exact Mass | 477.96 |
| IUPAC Name | N-[2-(1,3-benzothiazol-2-ylamino)ethyl]-2-[2-(4-bromothiophen-2-yl)-1,3-thiazol-4-yl]acetamide |
| SMILES | O=C(Cc1csc(-c2cc(Br)cs2)n1)NCCNc1nc2ccccc2s1 |
| InChI | InChI=1S/C18H15BrN4OS3/c19-11-7-15(25-9-11)17-22-12(10-26-17)8-16(24)20-5-6-21-18-23-13-3-1-2-4-14(13)27-18/h1-4,7,9-10H,5-6,8H2,(H,20,24)(H,21,23) |
| InChIKey | LGRGUVHFQLAKGA-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.45 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|