C17H13BrClN3O2S2 — CID 55857445
N'-[2-[2-(4-bromothiophen-2-yl)-1,3-thiazol-4-yl]acetyl]-2-(4-chlorophenyl)acetohydrazide (PubChem CID 55857445) has the molecular formula C17H13BrClN3O2S2 and a molecular weight of 470.80 g/mol. Its IUPAC name is N'-[2-[2-(4-bromothiophen-2-yl)-1,3-thiazol-4-yl]acetyl]-2-(4-chlorophenyl)acetohydrazide.
| Compound Name | N'-[2-[2-(4-bromothiophen-2-yl)-1,3-thiazol-4-yl]acetyl]-2-(4-chlorophenyl)acetohydrazide |
|---|---|
| PubChem CID | 55857445 |
| Molecular Formula | C17H13BrClN3O2S2 |
| Molecular Weight | 470.80 g/mol |
| Exact Mass | 468.93 |
| IUPAC Name | N'-[2-[2-(4-bromothiophen-2-yl)-1,3-thiazol-4-yl]acetyl]-2-(4-chlorophenyl)acetohydrazide |
| SMILES | O=C(Cc1ccc(Cl)cc1)NNC(=O)Cc1csc(-c2cc(Br)cs2)n1 |
| InChI | InChI=1S/C17H13BrClN3O2S2/c18-11-6-14(25-8-11)17-20-13(9-26-17)7-16(24)22-21-15(23)5-10-1-3-12(19)4-2-10/h1-4,6,8-9H,5,7H2,(H,21,23)(H,22,24) |
| InChIKey | ZMTLBQHQAJBWAT-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.80 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|