C17H14ClN3O2S3 — CID 34056496
N'-[2-(4-chlorophenyl)sulfanylacetyl]-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetohydrazide (PubChem CID 34056496) has the molecular formula C17H14ClN3O2S3 and a molecular weight of 423.97 g/mol. Its IUPAC name is N'-[2-(4-chlorophenyl)sulfanylacetyl]-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetohydrazide.
| Compound Name | N'-[2-(4-chlorophenyl)sulfanylacetyl]-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetohydrazide |
|---|---|
| PubChem CID | 34056496 |
| Molecular Formula | C17H14ClN3O2S3 |
| Molecular Weight | 423.97 g/mol |
| Exact Mass | 422.99 |
| IUPAC Name | N'-[2-(4-chlorophenyl)sulfanylacetyl]-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetohydrazide |
| SMILES | O=C(CSc1ccc(Cl)cc1)NNC(=O)Cc1csc(-c2ccsc2)n1 |
| InChI | InChI=1S/C17H14ClN3O2S3/c18-12-1-3-14(4-2-12)25-10-16(23)21-20-15(22)7-13-9-26-17(19-13)11-5-6-24-8-11/h1-6,8-9H,7,10H2,(H,20,22)(H,21,23) |
| InChIKey | YUBGODWMFLXCHN-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.97 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|