C17H16ClN3OS2 — CID 55825141
N-[3-chloro-4-(dimethylamino)phenyl]-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetamide (PubChem CID 55825141) has the molecular formula C17H16ClN3OS2 and a molecular weight of 377.92 g/mol. Its IUPAC name is N-[3-chloro-4-(dimethylamino)phenyl]-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-[3-chloro-4-(dimethylamino)phenyl]-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 55825141 |
| Molecular Formula | C17H16ClN3OS2 |
| Molecular Weight | 377.92 g/mol |
| Exact Mass | 377.04 |
| IUPAC Name | N-[3-chloro-4-(dimethylamino)phenyl]-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetamide |
| SMILES | CN(C)c1ccc(NC(=O)Cc2csc(-c3ccsc3)n2)cc1Cl |
| InChI | InChI=1S/C17H16ClN3OS2/c1-21(2)15-4-3-12(7-14(15)18)19-16(22)8-13-10-24-17(20-13)11-5-6-23-9-11/h3-7,9-10H,8H2,1-2H3,(H,19,22) |
| InChIKey | HEXCNRNKXDXCJS-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.92 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|