C19H16N4O3S2 — CID 51949429
N-[3-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl]-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetamide (PubChem CID 51949429) has the molecular formula C19H16N4O3S2 and a molecular weight of 412.50 g/mol. Its IUPAC name is N-[3-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl]-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-[3-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl]-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 51949429 |
| Molecular Formula | C19H16N4O3S2 |
| Molecular Weight | 412.50 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | N-[3-[(4S)-4-methyl-2,5-dioxoimidazolidin-4-yl]phenyl]-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetamide |
| SMILES | C[C@@]1(c2cccc(NC(=O)Cc3csc(-c4ccsc4)n3)c2)NC(=O)NC1=O |
| InChI | InChI=1S/C19H16N4O3S2/c1-19(17(25)22-18(26)23-19)12-3-2-4-13(7-12)20-15(24)8-14-10-28-16(21-14)11-5-6-27-9-11/h2-7,9-10H,8H2,1H3,(H,20,24)(H2,22,23,25,26)/t19-/m0/s1 |
| InChIKey | YAQIZFIXQIWYNY-IBGZPJMESA-N |
| XLogP | 3.11 |
| TPSA | 100.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.50 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|