C17H13N3O5S2 — CID 9129391
[2-(3-nitroanilino)-2-oxoethyl] 2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetate (PubChem CID 9129391) has the molecular formula C17H13N3O5S2 and a molecular weight of 403.44 g/mol. Its IUPAC name is [2-(3-nitroanilino)-2-oxoethyl] 2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetate.
| Compound Name | [2-(3-nitroanilino)-2-oxoethyl] 2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetate |
|---|---|
| PubChem CID | 9129391 |
| Molecular Formula | C17H13N3O5S2 |
| Molecular Weight | 403.44 g/mol |
| Exact Mass | 403.03 |
| IUPAC Name | [2-(3-nitroanilino)-2-oxoethyl] 2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetate |
| SMILES | O=C(COC(=O)Cc1csc(-c2ccsc2)n1)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H13N3O5S2/c21-15(18-12-2-1-3-14(6-12)20(23)24)8-25-16(22)7-13-10-27-17(19-13)11-4-5-26-9-11/h1-6,9-10H,7-8H2,(H,18,21) |
| InChIKey | RLGYZXPJQJRXNN-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.44 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|