C16H12N2O4S2 — CID 9129682
(2-nitrophenyl)methyl 2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetate (PubChem CID 9129682) has the molecular formula C16H12N2O4S2 and a molecular weight of 360.42 g/mol. Its IUPAC name is (2-nitrophenyl)methyl 2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetate.
| Compound Name | (2-nitrophenyl)methyl 2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetate |
|---|---|
| PubChem CID | 9129682 |
| Molecular Formula | C16H12N2O4S2 |
| Molecular Weight | 360.42 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | (2-nitrophenyl)methyl 2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetate |
| SMILES | O=C(Cc1csc(-c2ccsc2)n1)OCc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C16H12N2O4S2/c19-15(22-8-11-3-1-2-4-14(11)18(20)21)7-13-10-24-16(17-13)12-5-6-23-9-12/h1-6,9-10H,7-8H2 |
| InChIKey | BFJPYOJYKCEVHU-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 82.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.42 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|