C16H11N3OS2 — CID 8927230
N-(3-cyanophenyl)-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetamide (PubChem CID 8927230) has the molecular formula C16H11N3OS2 and a molecular weight of 325.42 g/mol. Its IUPAC name is N-(3-cyanophenyl)-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetamide.
| Compound Name | N-(3-cyanophenyl)-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetamide |
|---|---|
| PubChem CID | 8927230 |
| Molecular Formula | C16H11N3OS2 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | N-(3-cyanophenyl)-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetamide |
| SMILES | N#Cc1cccc(NC(=O)Cc2csc(-c3ccsc3)n2)c1 |
| InChI | InChI=1S/C16H11N3OS2/c17-8-11-2-1-3-13(6-11)18-15(20)7-14-10-22-16(19-14)12-4-5-21-9-12/h1-6,9-10H,7H2,(H,18,20) |
| InChIKey | JNAOGLHGDXTPGI-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 65.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |