C18H18N4O3S2 — CID 18283839
N'-[2-(4-methoxyanilino)acetyl]-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetohydrazide (PubChem CID 18283839) has the molecular formula C18H18N4O3S2 and a molecular weight of 402.50 g/mol. Its IUPAC name is N'-[2-(4-methoxyanilino)acetyl]-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetohydrazide.
| Compound Name | N'-[2-(4-methoxyanilino)acetyl]-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetohydrazide |
|---|---|
| PubChem CID | 18283839 |
| Molecular Formula | C18H18N4O3S2 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | N'-[2-(4-methoxyanilino)acetyl]-2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetohydrazide |
| SMILES | COc1ccc(NCC(=O)NNC(=O)Cc2csc(-c3ccsc3)n2)cc1 |
| InChI | InChI=1S/C18H18N4O3S2/c1-25-15-4-2-13(3-5-15)19-9-17(24)22-21-16(23)8-14-11-27-18(20-14)12-6-7-26-10-12/h2-7,10-11,19H,8-9H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | KABUCQUVBWHELL-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|