C19H17Cl2N3O3S2 — CID 55406349
4-(2,4-dichlorophenoxy)-N'-[2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetyl]butanehydrazide (PubChem CID 55406349) has the molecular formula C19H17Cl2N3O3S2 and a molecular weight of 470.40 g/mol. Its IUPAC name is 4-(2,4-dichlorophenoxy)-N'-[2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetyl]butanehydrazide.
| Compound Name | 4-(2,4-dichlorophenoxy)-N'-[2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetyl]butanehydrazide |
|---|---|
| PubChem CID | 55406349 |
| Molecular Formula | C19H17Cl2N3O3S2 |
| Molecular Weight | 470.40 g/mol |
| Exact Mass | 469.01 |
| IUPAC Name | 4-(2,4-dichlorophenoxy)-N'-[2-(2-thiophen-3-yl-1,3-thiazol-4-yl)acetyl]butanehydrazide |
| SMILES | O=C(CCCOc1ccc(Cl)cc1Cl)NNC(=O)Cc1csc(-c2ccsc2)n1 |
| InChI | InChI=1S/C19H17Cl2N3O3S2/c20-13-3-4-16(15(21)8-13)27-6-1-2-17(25)23-24-18(26)9-14-11-29-19(22-14)12-5-7-28-10-12/h3-5,7-8,10-11H,1-2,6,9H2,(H,23,25)(H,24,26) |
| InChIKey | CXBASQFWCAQEIO-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.40 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|